C25H28N4O5S — CID 91803065
[2-[4-[2,6-dioxo-8-(4-phenylbutyl)-7H-purin-3-yl]butyl]phenyl] hydrogen sulfite (PubChem CID 91803065) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is [2-[4-[2,6-dioxo-8-(4-phenylbutyl)-7H-purin-3-yl]butyl]phenyl] hydrogen sulfite.
| Compound Name | [2-[4-[2,6-dioxo-8-(4-phenylbutyl)-7H-purin-3-yl]butyl]phenyl] hydrogen sulfite |
|---|---|
| PubChem CID | 91803065 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | [2-[4-[2,6-dioxo-8-(4-phenylbutyl)-7H-purin-3-yl]butyl]phenyl] hydrogen sulfite |
| SMILES | O=c1[nH]c(=O)n(CCCCc2ccccc2OS(=O)O)c2nc(CCCCc3ccccc3)[nH]c12 |
| InChI | InChI=1S/C25H28N4O5S/c30-24-22-23(27-21(26-22)16-7-4-12-18-10-2-1-3-11-18)29(25(31)28-24)17-9-8-14-19-13-5-6-15-20(19)34-35(32)33/h1-3,5-6,10-11,13,15H,4,7-9,12,14,16-17H2,(H,26,27)(H,32,33)(H,28,30,31) |
| InChIKey | ZTQREXNKXQCYND-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 130.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|