C21H18F2N4O2 — CID 46233314
3-benzyl-8-[(2,6-difluorophenyl)methyl]-1-ethyl-7H-purine-2,6-dione (PubChem CID 46233314) has the molecular formula C21H18F2N4O2 and a molecular weight of 396.40 g/mol. Its IUPAC name is 3-benzyl-8-[(2,6-difluorophenyl)methyl]-1-ethyl-7H-purine-2,6-dione.
| Compound Name | 3-benzyl-8-[(2,6-difluorophenyl)methyl]-1-ethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 46233314 |
| Molecular Formula | C21H18F2N4O2 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 3-benzyl-8-[(2,6-difluorophenyl)methyl]-1-ethyl-7H-purine-2,6-dione |
| SMILES | CCn1c(=O)c2[nH]c(Cc3c(F)cccc3F)nc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C21H18F2N4O2/c1-2-26-20(28)18-19(27(21(26)29)12-13-7-4-3-5-8-13)25-17(24-18)11-14-15(22)9-6-10-16(14)23/h3-10H,2,11-12H2,1H3,(H,24,25) |
| InChIKey | TYJIRYPLRGHCOH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |