C13H19N7O2 — CID 135408719
1,3-dimethyl-8-[(E)-(2-methylpiperidin-1-yl)diazenyl]-7H-purine-2,6-dione (PubChem CID 135408719) has the molecular formula C13H19N7O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 1,3-dimethyl-8-[(E)-(2-methylpiperidin-1-yl)diazenyl]-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-[(E)-(2-methylpiperidin-1-yl)diazenyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 135408719 |
| Molecular Formula | C13H19N7O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1,3-dimethyl-8-[(E)-(2-methylpiperidin-1-yl)diazenyl]-7H-purine-2,6-dione |
| SMILES | CC1CCCCN1/N=N/c1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H19N7O2/c1-8-6-4-5-7-20(8)17-16-12-14-9-10(15-12)18(2)13(22)19(3)11(9)21/h8H,4-7H2,1-3H3,(H,14,15)/b17-16+ |
| InChIKey | HIGWGWZKJVLWIX-WUKNDPDISA-N |
| XLogP | 0.83 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|