C15H17N7O2 — CID 4525125
8-[(3,4-dimethylanilino)diazenyl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 4525125) has the molecular formula C15H17N7O2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 8-[(3,4-dimethylanilino)diazenyl]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[(3,4-dimethylanilino)diazenyl]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 4525125 |
| Molecular Formula | C15H17N7O2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 8-[(3,4-dimethylanilino)diazenyl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cc1ccc(NN=Nc2nc3c([nH]2)c(=O)n(C)c(=O)n3C)cc1C |
| InChI | InChI=1S/C15H17N7O2/c1-8-5-6-10(7-9(8)2)18-20-19-14-16-11-12(17-14)21(3)15(24)22(4)13(11)23/h5-7H,1-4H3,(H2,16,17,18,19) |
| InChIKey | OWYVINRYXXOABX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|