C11H12FN3O3S — CID 71347080
(2S)-2-acetamido-3-[(4-fluorophenyl)diazenyl]sulfanylpropanoic acid (PubChem CID 71347080) has the molecular formula C11H12FN3O3S and a molecular weight of 285.30 g/mol. Its IUPAC name is (2S)-2-acetamido-3-[(4-fluorophenyl)diazenyl]sulfanylpropanoic acid.
| Compound Name | (2S)-2-acetamido-3-[(4-fluorophenyl)diazenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 71347080 |
| Molecular Formula | C11H12FN3O3S |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (2S)-2-acetamido-3-[(4-fluorophenyl)diazenyl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@H](CS/N=N/c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C11H12FN3O3S/c1-7(16)13-10(11(17)18)6-19-15-14-9-4-2-8(12)3-5-9/h2-5,10H,6H2,1H3,(H,13,16)(H,17,18)/b15-14+/t10-/m1/s1 |
| InChIKey | RXADZMXHSMPBLO-KDGRRTAISA-N |
| XLogP | 2.15 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|