C11H11N4O5S- — CID 9442587
(2S)-2-acetamido-3-[(4-nitrophenyl)diazenyl]sulfanylpropanoate (PubChem CID 9442587) has the molecular formula C11H11N4O5S- and a molecular weight of 311.30 g/mol. Its IUPAC name is (2S)-2-acetamido-3-[(4-nitrophenyl)diazenyl]sulfanylpropanoate.
| Compound Name | (2S)-2-acetamido-3-[(4-nitrophenyl)diazenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 9442587 |
| Molecular Formula | C11H11N4O5S- |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (2S)-2-acetamido-3-[(4-nitrophenyl)diazenyl]sulfanylpropanoate |
| SMILES | CC(=O)N[C@H](CS/N=N/c1ccc([N+](=O)[O-])cc1)C(=O)[O-] |
| InChI | InChI=1S/C11H12N4O5S/c1-7(16)12-10(11(17)18)6-21-14-13-8-2-4-9(5-3-8)15(19)20/h2-5,10H,6H2,1H3,(H,12,16)(H,17,18)/p-1/b14-13+/t10-/m1/s1 |
| InChIKey | GRSSAOOZRGUMFE-WBNXYMAISA-M |
| XLogP | 0.58 |
| TPSA | 137.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|