C18H24N2O8S2 — CID 159320071
(5R)-5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-6-(4-methylphenyl)sulfonylsulfanyl-4-oxohexanoic acid (PubChem CID 159320071) has the molecular formula C18H24N2O8S2 and a molecular weight of 460.53 g/mol. Its IUPAC name is (5R)-5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-6-(4-methylphenyl)sulfonylsulfanyl-4-oxohexanoic acid.
| Compound Name | (5R)-5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-6-(4-methylphenyl)sulfonylsulfanyl-4-oxohexanoic acid |
|---|---|
| PubChem CID | 159320071 |
| Molecular Formula | C18H24N2O8S2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | (5R)-5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-6-(4-methylphenyl)sulfonylsulfanyl-4-oxohexanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C18H24N2O8S2/c1-11-2-4-12(5-3-11)30(27,28)29-10-14(15(21)7-9-17(23)24)20-16(22)8-6-13(19)18(25)26/h2-5,13-14H,6-10,19H2,1H3,(H,20,22)(H,23,24)(H,25,26)/t13-,14-/m0/s1 |
| InChIKey | WIAAIUKCYHPHGI-KBPBESRZSA-N |
| XLogP | 0.53 |
| TPSA | 180.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|