C13H25AsN2O4S — CID 58066883
5-(4-aminopentanoylamino)-6-dimethylarsanylsulfanyl-4-oxohexanoic acid (PubChem CID 58066883) has the molecular formula C13H25AsN2O4S and a molecular weight of 380.34 g/mol. Its IUPAC name is 5-(4-aminopentanoylamino)-6-dimethylarsanylsulfanyl-4-oxohexanoic acid.
| Compound Name | 5-(4-aminopentanoylamino)-6-dimethylarsanylsulfanyl-4-oxohexanoic acid |
|---|---|
| PubChem CID | 58066883 |
| Molecular Formula | C13H25AsN2O4S |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 5-(4-aminopentanoylamino)-6-dimethylarsanylsulfanyl-4-oxohexanoic acid |
| SMILES | CC(N)CCC(=O)NC(CS[As](C)C)C(=O)CCC(=O)O |
| InChI | InChI=1S/C13H25AsN2O4S/c1-9(15)4-6-12(18)16-10(8-21-14(2)3)11(17)5-7-13(19)20/h9-10H,4-8,15H2,1-3H3,(H,16,18)(H,19,20) |
| InChIKey | KXZUUBRGMSOQNX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|