C13H16N2O7S — CID 25138182
(2R)-2-[(4-acetamidophenyl)sulfonylamino]pentanedioic acid (PubChem CID 25138182) has the molecular formula C13H16N2O7S and a molecular weight of 344.35 g/mol. Its IUPAC name is (2R)-2-[(4-acetamidophenyl)sulfonylamino]pentanedioic acid.
| Compound Name | (2R)-2-[(4-acetamidophenyl)sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 25138182 |
| Molecular Formula | C13H16N2O7S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (2R)-2-[(4-acetamidophenyl)sulfonylamino]pentanedioic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C13H16N2O7S/c1-8(16)14-9-2-4-10(5-3-9)23(21,22)15-11(13(19)20)6-7-12(17)18/h2-5,11,15H,6-7H2,1H3,(H,14,16)(H,17,18)(H,19,20)/t11-/m1/s1 |
| InChIKey | MHMRNCCXQWLFRC-LLVKDONJSA-N |
| XLogP | 0.24 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |