C12H16N2O4S2 — CID 107769049
2-acetamido-N-(4-methylsulfonylphenyl)-3-sulfanylpropanamide (PubChem CID 107769049) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-acetamido-N-(4-methylsulfonylphenyl)-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-(4-methylsulfonylphenyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769049 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-acetamido-N-(4-methylsulfonylphenyl)-3-sulfanylpropanamide |
| SMILES | CC(=O)NC(CS)C(=O)Nc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H16N2O4S2/c1-8(15)13-11(7-19)12(16)14-9-3-5-10(6-4-9)20(2,17)18/h3-6,11,19H,7H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | JZBAMRYAHXKRCJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|