C11H12F3N3O2S — CID 107769779
2-acetamido-3-sulfanyl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide (PubChem CID 107769779) has the molecular formula C11H12F3N3O2S and a molecular weight of 307.30 g/mol. Its IUPAC name is 2-acetamido-3-sulfanyl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide.
| Compound Name | 2-acetamido-3-sulfanyl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 107769779 |
| Molecular Formula | C11H12F3N3O2S |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-acetamido-3-sulfanyl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide |
| SMILES | CC(=O)NC(CS)C(=O)Nc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C11H12F3N3O2S/c1-6(18)16-8(5-20)10(19)17-7-2-3-9(15-4-7)11(12,13)14/h2-4,8,20H,5H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | ONMFNWVVXPQZHQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|