C11H14N2O3S — CID 12850521
2-acetamido-N-(4-hydroxyphenyl)-3-sulfanylpropanamide (PubChem CID 12850521) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-acetamido-N-(4-hydroxyphenyl)-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-(4-hydroxyphenyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 12850521 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-acetamido-N-(4-hydroxyphenyl)-3-sulfanylpropanamide |
| SMILES | CC(=O)NC(CS)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C11H14N2O3S/c1-7(14)12-10(6-17)11(16)13-8-2-4-9(15)5-3-8/h2-5,10,15,17H,6H2,1H3,(H,12,14)(H,13,16) |
| InChIKey | YGCVGTCPKAARSA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|