C18H17NO3S — CID 23561546
2-[4-(2-methylprop-2-enoylamino)phenyl]sulfanyl-2-phenylacetic acid (PubChem CID 23561546) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-[4-(2-methylprop-2-enoylamino)phenyl]sulfanyl-2-phenylacetic acid.
| Compound Name | 2-[4-(2-methylprop-2-enoylamino)phenyl]sulfanyl-2-phenylacetic acid |
|---|---|
| PubChem CID | 23561546 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[4-(2-methylprop-2-enoylamino)phenyl]sulfanyl-2-phenylacetic acid |
| SMILES | C=C(C)C(=O)Nc1ccc(SC(C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17NO3S/c1-12(2)17(20)19-14-8-10-15(11-9-14)23-16(18(21)22)13-6-4-3-5-7-13/h3-11,16H,1H2,2H3,(H,19,20)(H,21,22) |
| InChIKey | GFMPVJLWESEIAW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|