C32H37N2O5S- — CID 90995095
4-methylaniline;2-[4-(2-methylprop-2-enoylamino)phenyl]sulfanyl-2-phenylacetate;propyl 2-methylprop-2-enoate (PubChem CID 90995095) has the molecular formula C32H37N2O5S- and a molecular weight of 561.72 g/mol. Its IUPAC name is 4-methylaniline;2-[4-(2-methylprop-2-enoylamino)phenyl]sulfanyl-2-phenylacetate;propyl 2-methylprop-2-enoate.
| Compound Name | 4-methylaniline;2-[4-(2-methylprop-2-enoylamino)phenyl]sulfanyl-2-phenylacetate;propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90995095 |
| Molecular Formula | C32H37N2O5S- |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | 4-methylaniline;2-[4-(2-methylprop-2-enoylamino)phenyl]sulfanyl-2-phenylacetate;propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Nc1ccc(SC(C(=O)[O-])c2ccccc2)cc1.C=C(C)C(=O)OCCC.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C18H17NO3S.C7H9N.C7H12O2/c1-12(2)17(20)19-14-8-10-15(11-9-14)23-16(18(21)22)13-6-4-3-5-7-13;1-6-2-4-7(8)5-3-6;1-4-5-9-7(8)6(2)3/h3-11,16H,1H2,2H3,(H,19,20)(H,21,22);2-5H,8H2,1H3;2,4-5H2,1,3H3/p-1 |
| InChIKey | VGFDRYAQPHXEJR-UHFFFAOYSA-M |
| XLogP | 5.88 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|