C24H31N3O9 — CID 3543299
N-[2-[[2-(4-acetylanilino)-2-oxoethyl]amino]-2-oxoethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 3543299) has the molecular formula C24H31N3O9 and a molecular weight of 505.52 g/mol. Its IUPAC name is N-[2-[[2-(4-acetylanilino)-2-oxoethyl]amino]-2-oxoethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | N-[2-[[2-(4-acetylanilino)-2-oxoethyl]amino]-2-oxoethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 3543299 |
| Molecular Formula | C24H31N3O9 |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-[2-[[2-(4-acetylanilino)-2-oxoethyl]amino]-2-oxoethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)CNC(=O)CNC(=O)C2OC3OC(C)(C)OC3C3OC(C)(C)OC23)cc1 |
| InChI | InChI=1S/C24H31N3O9/c1-12(28)13-6-8-14(9-7-13)27-16(30)11-25-15(29)10-26-21(31)19-17-18(34-23(2,3)33-17)20-22(32-19)36-24(4,5)35-20/h6-9,17-20,22H,10-11H2,1-5H3,(H,25,29)(H,26,31)(H,27,30) |
| InChIKey | CZZXDIHZMJQBGQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |