C21H29NO7 — CID 22696395
N-[2-(2-methoxyphenyl)ethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 22696395) has the molecular formula C21H29NO7 and a molecular weight of 407.46 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)ethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | N-[2-(2-methoxyphenyl)ethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 22696395 |
| Molecular Formula | C21H29NO7 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[2-(2-methoxyphenyl)ethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)C1OC2OC(C)(C)OC2C2OC(C)(C)OC12 |
| InChI | InChI=1S/C21H29NO7/c1-20(2)26-14-15(27-20)17-19(29-21(3,4)28-17)25-16(14)18(23)22-11-10-12-8-6-7-9-13(12)24-5/h6-9,14-17,19H,10-11H2,1-5H3,(H,22,23) |
| InChIKey | YXTQSUPOLUBIBW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |