C20H25NO8 — CID 11891018
methyl 2-[[(1S,2R,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]benzoate (PubChem CID 11891018) has the molecular formula C20H25NO8 and a molecular weight of 407.42 g/mol. Its IUPAC name is methyl 2-[[(1S,2R,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[(1S,2R,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 11891018 |
| Molecular Formula | C20H25NO8 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | methyl 2-[[(1S,2R,6S,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)[C@@H]1O[C@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C20H25NO8/c1-19(2)26-12-13(27-19)15-18(29-20(3,4)28-15)25-14(12)16(22)21-11-9-7-6-8-10(11)17(23)24-5/h6-9,12-15,18H,1-5H3,(H,21,22)/t12-,13-,14+,15+,18-/m0/s1 |
| InChIKey | CPGSEYHVBKEJHT-YPIIOCQESA-N |
| XLogP | 1.81 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |