C19H24O6Se — CID 102054460
Se-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl] benzenecarboselenoate (PubChem CID 102054460) has the molecular formula C19H24O6Se and a molecular weight of 427.36 g/mol. Its IUPAC name is Se-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl] benzenecarboselenoate.
| Compound Name | Se-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl] benzenecarboselenoate |
|---|---|
| PubChem CID | 102054460 |
| Molecular Formula | C19H24O6Se |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | Se-[[(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl] benzenecarboselenoate |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](C[Se]C(=O)c1ccccc1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C19H24O6Se/c1-18(2)22-13-12(10-26-16(20)11-8-6-5-7-9-11)21-17-15(14(13)23-18)24-19(3,4)25-17/h5-9,12-15,17H,10H2,1-4H3/t12-,13+,14+,15-,17-/m1/s1 |
| InChIKey | JXYHXTFPIYUDMQ-RUCLQGLUSA-N |
| XLogP | 2.35 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|