C14H22O7 — CID 11822779
3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoic acid (PubChem CID 11822779) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is 3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoic acid.
| Compound Name | 3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoic acid |
|---|---|
| PubChem CID | 11822779 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoic acid |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CCC(=O)O)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H22O7/c1-13(2)18-9-7(5-6-8(15)16)17-12-11(10(9)19-13)20-14(3,4)21-12/h7,9-12H,5-6H2,1-4H3,(H,15,16)/t7-,9+,10+,11-,12-/m1/s1 |
| InChIKey | OAUAJOVFRSBTFE-NBIDRCSRSA-N |
| XLogP | 1.25 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |