C16H25NO8 — CID 45037071
4-oxo-4-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylamino]butanoic acid (PubChem CID 45037071) has the molecular formula C16H25NO8 and a molecular weight of 359.38 g/mol. Its IUPAC name is 4-oxo-4-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylamino]butanoic acid.
| Compound Name | 4-oxo-4-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 45037071 |
| Molecular Formula | C16H25NO8 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-oxo-4-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylamino]butanoic acid |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CNC(=O)CCC(=O)O)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H25NO8/c1-15(2)22-11-8(7-17-9(18)5-6-10(19)20)21-14-13(12(11)23-15)24-16(3,4)25-14/h8,11-14H,5-7H2,1-4H3,(H,17,18)(H,19,20)/t8-,11+,12+,13-,14-/m1/s1 |
| InChIKey | VETXOUBOXVHVHN-AEOCFKNESA-N |
| XLogP | 0.36 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |