C18H31N3O6 — CID 11025458
4-methyl-N-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]piperazine-1-carboxamide (PubChem CID 11025458) has the molecular formula C18H31N3O6 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-methyl-N-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]piperazine-1-carboxamide.
| Compound Name | 4-methyl-N-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 11025458 |
| Molecular Formula | C18H31N3O6 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 4-methyl-N-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]piperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)NC[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]3OC(C)(C)O[C@H]32)CC1 |
| InChI | InChI=1S/C18H31N3O6/c1-17(2)24-12-11(10-19-16(22)21-8-6-20(5)7-9-21)23-15-14(13(12)25-17)26-18(3,4)27-15/h11-15H,6-10H2,1-5H3,(H,19,22)/t11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | VTDCYDOPMRNVET-GZBLMMOJSA-N |
| XLogP | 0.34 |
| TPSA | 81.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |