C17H24N2O9 — CID 163148538
N-hydroxy-5-[[(1R,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylcarbamoyl]furan-2-amine oxide (PubChem CID 163148538) has the molecular formula C17H24N2O9 and a molecular weight of 400.38 g/mol. Its IUPAC name is N-hydroxy-5-[[(1R,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylcarbamoyl]furan-2-amine oxide.
| Compound Name | N-hydroxy-5-[[(1R,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylcarbamoyl]furan-2-amine oxide |
|---|---|
| PubChem CID | 163148538 |
| Molecular Formula | C17H24N2O9 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-hydroxy-5-[[(1R,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylcarbamoyl]furan-2-amine oxide |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](CNC(=O)c1ccc([NH+]([O-])O)o1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C17H24N2O9/c1-16(2)25-11-9(7-18-14(20)8-5-6-10(23-8)19(21)22)24-15-13(12(11)26-16)27-17(3,4)28-15/h5-6,9,11-13,15,19,21H,7H2,1-4H3,(H,18,20)/t9-,11+,12-,13-,15-/m1/s1 |
| InChIKey | MLXYZLORBCYBBS-DJEPCVJESA-N |
| XLogP | -0.19 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|