C21H35BrN2O7 — CID 56837320
2-bromo-N-tert-butyl-2-methyl-N-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylcarbamoyl]propanamide (PubChem CID 56837320) has the molecular formula C21H35BrN2O7 and a molecular weight of 507.42 g/mol. Its IUPAC name is 2-bromo-N-tert-butyl-2-methyl-N-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylcarbamoyl]propanamide.
| Compound Name | 2-bromo-N-tert-butyl-2-methyl-N-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylcarbamoyl]propanamide |
|---|---|
| PubChem CID | 56837320 |
| Molecular Formula | C21H35BrN2O7 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 2-bromo-N-tert-butyl-2-methyl-N-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methylcarbamoyl]propanamide |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](CNC(=O)N(C(=O)C(C)(C)Br)C(C)(C)C)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C21H35BrN2O7/c1-18(2,3)24(16(25)19(4,5)22)17(26)23-10-11-12-13(29-20(6,7)28-12)14-15(27-11)31-21(8,9)30-14/h11-15H,10H2,1-9H3,(H,23,26)/t11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | WOHCCYJQKSROKZ-GZBLMMOJSA-N |
| XLogP | 2.89 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|