C25H30O6 — CID 101089350
(1R,2R,6R,8R,9R)-8-(benzhydryloxymethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 101089350) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is (1R,2R,6R,8R,9R)-8-(benzhydryloxymethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1R,2R,6R,8R,9R)-8-(benzhydryloxymethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 101089350 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (1R,2R,6R,8R,9R)-8-(benzhydryloxymethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)O[C@H]2O[C@H](COC(c3ccccc3)c3ccccc3)[C@H]3OC(C)(C)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C25H30O6/c1-24(2)28-20-18(27-23-22(21(20)29-24)30-25(3,4)31-23)15-26-19(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,18-23H,15H2,1-4H3/t18-,20-,21-,22-,23-/m1/s1 |
| InChIKey | HEKXYRZUCDSRRI-OKKOYFSCSA-N |
| XLogP | 4.19 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |