C19H25BrO6 — CID 90989639
(1S,2R,8R,9S)-8-[(2-bromophenyl)methoxymethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 90989639) has the molecular formula C19H25BrO6 and a molecular weight of 429.31 g/mol. Its IUPAC name is (1S,2R,8R,9S)-8-[(2-bromophenyl)methoxymethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,8R,9S)-8-[(2-bromophenyl)methoxymethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 90989639 |
| Molecular Formula | C19H25BrO6 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | (1S,2R,8R,9S)-8-[(2-bromophenyl)methoxymethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1OC(C)(C)OC1O[C@@H]2COCc1ccccc1Br |
| InChI | InChI=1S/C19H25BrO6/c1-18(2)23-14-13(10-21-9-11-7-5-6-8-12(11)20)22-17-16(15(14)24-18)25-19(3,4)26-17/h5-8,13-17H,9-10H2,1-4H3/t13-,14+,15+,16-,17?/m1/s1 |
| InChIKey | AADOHUOFCXFOTA-MFVZMDDISA-N |
| XLogP | 3.36 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |