C24H28O9S — CID 166033883
(4-phenylphenyl) [(1S,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl sulfate (PubChem CID 166033883) has the molecular formula C24H28O9S and a molecular weight of 492.55 g/mol. Its IUPAC name is (4-phenylphenyl) [(1S,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl sulfate.
| Compound Name | (4-phenylphenyl) [(1S,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl sulfate |
|---|---|
| PubChem CID | 166033883 |
| Molecular Formula | C24H28O9S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | (4-phenylphenyl) [(1S,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl sulfate |
| SMILES | CC1(C)OC2[C@H](OC(COS(=O)(=O)Oc3ccc(-c4ccccc4)cc3)[C@@H]3OC(C)(C)O[C@H]23)O1 |
| InChI | InChI=1S/C24H28O9S/c1-23(2)29-19-18(28-22-21(20(19)30-23)31-24(3,4)32-22)14-27-34(25,26)33-17-12-10-16(11-13-17)15-8-6-5-7-9-15/h5-13,18-22H,14H2,1-4H3/t18?,19-,20-,21?,22+/m0/s1 |
| InChIKey | QBJWEFSVVBDZOM-ZHGPVEJGSA-N |
| XLogP | 3.39 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |