C13H21NO6 — CID 86588181
1-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-hydroxyiminopentan-3-one (PubChem CID 86588181) has the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-hydroxyiminopentan-3-one.
| Compound Name | 1-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-hydroxyiminopentan-3-one |
|---|---|
| PubChem CID | 86588181 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-hydroxyiminopentan-3-one |
| SMILES | CCC(=O)CC(=NO)[C@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C13H21NO6/c1-5-7(15)6-8(14-16)9-10-11(12(17-4)18-9)20-13(2,3)19-10/h9-12,16H,5-6H2,1-4H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | NHMPBWJFSNZZLO-DDHJBXDOSA-N |
| XLogP | 1.08 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|