C21H32O5 — CID 14313262
(2,6-dimethylphenyl) (2R,3R,4R)-3-hydroxy-2-methyl-4-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentanoate (PubChem CID 14313262) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is (2,6-dimethylphenyl) (2R,3R,4R)-3-hydroxy-2-methyl-4-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentanoate.
| Compound Name | (2,6-dimethylphenyl) (2R,3R,4R)-3-hydroxy-2-methyl-4-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentanoate |
|---|---|
| PubChem CID | 14313262 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (2,6-dimethylphenyl) (2R,3R,4R)-3-hydroxy-2-methyl-4-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentanoate |
| SMILES | Cc1cccc(C)c1OC(=O)[C@H](C)[C@H](O)[C@@H](C)[C@@H]1OC(C)(C)OC[C@@H]1C |
| InChI | InChI=1S/C21H32O5/c1-12-9-8-10-13(2)18(12)25-20(23)16(5)17(22)15(4)19-14(3)11-24-21(6,7)26-19/h8-10,14-17,19,22H,11H2,1-7H3/t14-,15+,16+,17+,19+/m0/s1 |
| InChIKey | PJNVRNYTEODGQE-SEFVSHJNSA-N |
| XLogP | 3.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|