C16H30O3S2 — CID 50993179
O-[(2S,3R,4R)-4-methyl-2-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]hexan-3-yl] methylsulfanylmethanethioate (PubChem CID 50993179) has the molecular formula C16H30O3S2 and a molecular weight of 334.55 g/mol. Its IUPAC name is O-[(2S,3R,4R)-4-methyl-2-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]hexan-3-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(2S,3R,4R)-4-methyl-2-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]hexan-3-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 50993179 |
| Molecular Formula | C16H30O3S2 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | O-[(2S,3R,4R)-4-methyl-2-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]hexan-3-yl] methylsulfanylmethanethioate |
| SMILES | CC[C@@H](C)[C@@H](OC(=S)SC)[C@@H](C)[C@@H]1OC(C)(C)OC[C@H]1C |
| InChI | InChI=1S/C16H30O3S2/c1-8-10(2)13(18-15(20)21-7)12(4)14-11(3)9-17-16(5,6)19-14/h10-14H,8-9H2,1-7H3/t10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | GWKCVDSXOZSMDC-DHGKCCLASA-N |
| XLogP | 4.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|