C21H40O3S2 — CID 57326635
O-[(2R,3S,4S,6S)-4,6,8-trimethyl-2-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]nonan-3-yl] methylsulfanylmethanethioate (PubChem CID 57326635) has the molecular formula C21H40O3S2 and a molecular weight of 404.68 g/mol. Its IUPAC name is O-[(2R,3S,4S,6S)-4,6,8-trimethyl-2-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]nonan-3-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(2R,3S,4S,6S)-4,6,8-trimethyl-2-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]nonan-3-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 57326635 |
| Molecular Formula | C21H40O3S2 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | O-[(2R,3S,4S,6S)-4,6,8-trimethyl-2-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]nonan-3-yl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)O[C@H]([C@H](C)[C@H]1OC(C)(C)OC[C@@H]1C)[C@@H](C)C[C@@H](C)CC(C)C |
| InChI | InChI=1S/C21H40O3S2/c1-13(2)10-14(3)11-15(4)18(23-20(25)26-9)17(6)19-16(5)12-22-21(7,8)24-19/h13-19H,10-12H2,1-9H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | HKLAKPNAAXWDNV-DYKIIFRCSA-N |
| XLogP | 6.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|