C15H28O4 — CID 56946557
[(2R,3R)-3-[(2R,4R)-4-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-2-yl]oxiran-2-yl]methanol (PubChem CID 56946557) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is [(2R,3R)-3-[(2R,4R)-4-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-2-yl]oxiran-2-yl]methanol.
| Compound Name | [(2R,3R)-3-[(2R,4R)-4-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-2-yl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 56946557 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | [(2R,3R)-3-[(2R,4R)-4-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-2-yl]oxiran-2-yl]methanol |
| SMILES | C[C@@H]1COC(C)(C)O[C@H]1[C@H](C)C[C@@H](C)[C@H]1O[C@@H]1CO |
| InChI | InChI=1S/C15H28O4/c1-9(6-10(2)14-12(7-16)18-14)13-11(3)8-17-15(4,5)19-13/h9-14,16H,6-8H2,1-5H3/t9-,10-,11-,12-,13+,14-/m1/s1 |
| InChIKey | ULAHEUTYMAHKNA-UCKQBZRPSA-N |
| XLogP | 2.20 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|