C14H28O3 — CID 10681760
(2R,4S)-2,4-dimethyl-5-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-1-ol (PubChem CID 10681760) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is (2R,4S)-2,4-dimethyl-5-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-1-ol.
| Compound Name | (2R,4S)-2,4-dimethyl-5-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-1-ol |
|---|---|
| PubChem CID | 10681760 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | (2R,4S)-2,4-dimethyl-5-[(4S,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-1-ol |
| SMILES | C[C@@H](CO)C[C@H](C)C[C@@H]1OC(C)(C)OC[C@H]1C |
| InChI | InChI=1S/C14H28O3/c1-10(6-11(2)8-15)7-13-12(3)9-16-14(4,5)17-13/h10-13,15H,6-9H2,1-5H3/t10-,11+,12+,13-/m0/s1 |
| InChIKey | MKRHRWGUNFSPOW-LOWDOPEQSA-N |
| XLogP | 2.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |