C11H21NO4 — CID 166447412
2-(2,2-dimethyl-1,3-dioxan-5-yl)-N-methoxy-N-methylpropanamide (PubChem CID 166447412) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,3-dioxan-5-yl)-N-methoxy-N-methylpropanamide.
| Compound Name | 2-(2,2-dimethyl-1,3-dioxan-5-yl)-N-methoxy-N-methylpropanamide |
|---|---|
| PubChem CID | 166447412 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 2-(2,2-dimethyl-1,3-dioxan-5-yl)-N-methoxy-N-methylpropanamide |
| SMILES | CON(C)C(=O)C(C)C1COC(C)(C)OC1 |
| InChI | InChI=1S/C11H21NO4/c1-8(10(13)12(4)14-5)9-6-15-11(2,3)16-7-9/h8-9H,6-7H2,1-5H3 |
| InChIKey | XIGWZIXCGOBJQN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|