C10H23N2O3P — CID 142567323
ethane;N-methoxy-N,2,2-trimethyl-3-phosphanyl-1,3-oxazolidine-4-carboxamide (PubChem CID 142567323) has the molecular formula C10H23N2O3P and a molecular weight of 250.28 g/mol. Its IUPAC name is ethane;N-methoxy-N,2,2-trimethyl-3-phosphanyl-1,3-oxazolidine-4-carboxamide.
| Compound Name | ethane;N-methoxy-N,2,2-trimethyl-3-phosphanyl-1,3-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 142567323 |
| Molecular Formula | C10H23N2O3P |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | ethane;N-methoxy-N,2,2-trimethyl-3-phosphanyl-1,3-oxazolidine-4-carboxamide |
| SMILES | CC.CON(C)C(=O)C1COC(C)(C)N1P |
| InChI | InChI=1S/C8H17N2O3P.C2H6/c1-8(2)10(14)6(5-13-8)7(11)9(3)12-4;1-2/h6H,5,14H2,1-4H3;1-2H3 |
| InChIKey | ZHPPDUNCUZGETQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|