C19H34O4 — CID 101168552
[(2S)-2-[(4R,5R,6S)-6-[(2S)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] 2,2-dimethylpropanoate (PubChem CID 101168552) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is [(2S)-2-[(4R,5R,6S)-6-[(2S)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-2-[(4R,5R,6S)-6-[(2S)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101168552 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | [(2S)-2-[(4R,5R,6S)-6-[(2S)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propyl] 2,2-dimethylpropanoate |
| SMILES | C=C[C@H](C)[C@@H]1OC(C)(C)O[C@H]([C@@H](C)COC(=O)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C19H34O4/c1-10-12(2)15-14(4)16(23-19(8,9)22-15)13(3)11-21-17(20)18(5,6)7/h10,12-16H,1,11H2,2-9H3/t12-,13-,14+,15-,16+/m0/s1 |
| InChIKey | WSCIHDZKGAEFDI-ARKGTOAJSA-N |
| XLogP | 4.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|