C10H15ClO3 — CID 102223369
(4S,5R)-5-[(2R)-but-3-en-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carbonyl chloride (PubChem CID 102223369) has the molecular formula C10H15ClO3 and a molecular weight of 218.68 g/mol. Its IUPAC name is (4S,5R)-5-[(2R)-but-3-en-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carbonyl chloride.
| Compound Name | (4S,5R)-5-[(2R)-but-3-en-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carbonyl chloride |
|---|---|
| PubChem CID | 102223369 |
| Molecular Formula | C10H15ClO3 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | (4S,5R)-5-[(2R)-but-3-en-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carbonyl chloride |
| SMILES | C=C[C@@H](C)[C@H]1OC(C)(C)O[C@@H]1C(=O)Cl |
| InChI | InChI=1S/C10H15ClO3/c1-5-6(2)7-8(9(11)12)14-10(3,4)13-7/h5-8H,1H2,2-4H3/t6-,7-,8+/m1/s1 |
| InChIKey | JUVMQYMBGMKKBY-PRJMDXOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|