C9H15BrO2 — CID 10728434
(4S,5R)-4-[(1S)-1-bromoprop-2-enyl]-2,2,5-trimethyl-1,3-dioxolane (PubChem CID 10728434) has the molecular formula C9H15BrO2 and a molecular weight of 235.12 g/mol. Its IUPAC name is (4S,5R)-4-[(1S)-1-bromoprop-2-enyl]-2,2,5-trimethyl-1,3-dioxolane.
| Compound Name | (4S,5R)-4-[(1S)-1-bromoprop-2-enyl]-2,2,5-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10728434 |
| Molecular Formula | C9H15BrO2 |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | (4S,5R)-4-[(1S)-1-bromoprop-2-enyl]-2,2,5-trimethyl-1,3-dioxolane |
| SMILES | C=C[C@H](Br)[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C9H15BrO2/c1-5-7(10)8-6(2)11-9(3,4)12-8/h5-8H,1H2,2-4H3/t6-,7+,8+/m1/s1 |
| InChIKey | PPVYRXNHXZXNRL-CSMHCCOUSA-N |
| XLogP | 2.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|