C16H28O5 — CID 51042523
(4R,5E,8R)-8-(methoxymethoxy)-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octa-1,5-dien-4-ol (PubChem CID 51042523) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is (4R,5E,8R)-8-(methoxymethoxy)-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octa-1,5-dien-4-ol.
| Compound Name | (4R,5E,8R)-8-(methoxymethoxy)-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octa-1,5-dien-4-ol |
|---|---|
| PubChem CID | 51042523 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (4R,5E,8R)-8-(methoxymethoxy)-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octa-1,5-dien-4-ol |
| SMILES | C=CC[C@@H](O)/C=C/C[C@@H](OCOC)[C@@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C16H28O5/c1-6-8-13(17)9-7-10-14(19-11-18-5)15-12(2)20-16(3,4)21-15/h6-7,9,12-15,17H,1,8,10-11H2,2-5H3/b9-7+/t12-,13-,14-,15-/m1/s1 |
| InChIKey | ASKRMASWJLQGAQ-AKFXSUOTSA-N |
| XLogP | 2.40 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|