C16H28O5 — CID 102339676
(1R)-1-[(4R,5R)-5-[(1S)-1-(methoxymethoxy)pentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-yn-1-ol (PubChem CID 102339676) has the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. Its IUPAC name is (1R)-1-[(4R,5R)-5-[(1S)-1-(methoxymethoxy)pentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-yn-1-ol.
| Compound Name | (1R)-1-[(4R,5R)-5-[(1S)-1-(methoxymethoxy)pentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 102339676 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (1R)-1-[(4R,5R)-5-[(1S)-1-(methoxymethoxy)pentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-yn-1-ol |
| SMILES | C#CC[C@@H](O)[C@H]1OC(C)(C)O[C@@H]1[C@H](CCCC)OCOC |
| InChI | InChI=1S/C16H28O5/c1-6-8-10-13(19-11-18-5)15-14(12(17)9-7-2)20-16(3,4)21-15/h2,12-15,17H,6,8-11H2,1,3-5H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | OKRKTANAFAQDFT-LXTVHRRPSA-N |
| XLogP | 2.07 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|