C14H26O7 — CID 102402644
(1S)-1-[(2S,3S,5R,6R)-3-[(1R)-1-hydroxybut-3-enyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]ethane-1,2-diol (PubChem CID 102402644) has the molecular formula C14H26O7 and a molecular weight of 306.36 g/mol. Its IUPAC name is (1S)-1-[(2S,3S,5R,6R)-3-[(1R)-1-hydroxybut-3-enyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(2S,3S,5R,6R)-3-[(1R)-1-hydroxybut-3-enyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 102402644 |
| Molecular Formula | C14H26O7 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (1S)-1-[(2S,3S,5R,6R)-3-[(1R)-1-hydroxybut-3-enyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]ethane-1,2-diol |
| SMILES | C=CC[C@@H](O)[C@@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@H]1[C@@H](O)CO |
| InChI | InChI=1S/C14H26O7/c1-6-7-9(16)11-12(10(17)8-15)21-14(3,19-5)13(2,18-4)20-11/h6,9-12,15-17H,1,7-8H2,2-5H3/t9-,10+,11+,12+,13-,14-/m1/s1 |
| InChIKey | VUMHTNDNGWQJBP-BBMNEWJDSA-N |
| XLogP | -0.21 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|