C12H22O5 — CID 101003174
(1S,2R)-1-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxypent-4-en-2-ol (PubChem CID 101003174) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is (1S,2R)-1-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxypent-4-en-2-ol.
| Compound Name | (1S,2R)-1-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxypent-4-en-2-ol |
|---|---|
| PubChem CID | 101003174 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (1S,2R)-1-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxypent-4-en-2-ol |
| SMILES | C=CC[C@@H](O)[C@H](OC)[C@H]1OC(C)(C)O[C@H]1CO |
| InChI | InChI=1S/C12H22O5/c1-5-6-8(14)10(15-4)11-9(7-13)16-12(2,3)17-11/h5,8-11,13-14H,1,6-7H2,2-4H3/t8-,9+,10+,11+/m1/s1 |
| InChIKey | YTYJKKBRKOREJE-RCWTZXSCSA-N |
| XLogP | 0.45 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|