C20H36O10 — CID 160522784
(2S)-1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxybut-3-en-2-ol;7-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-ol (PubChem CID 160522784) has the molecular formula C20H36O10 and a molecular weight of 436.50 g/mol. Its IUPAC name is (2S)-1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxybut-3-en-2-ol;7-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-ol.
| Compound Name | (2S)-1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxybut-3-en-2-ol;7-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-ol |
|---|---|
| PubChem CID | 160522784 |
| Molecular Formula | C20H36O10 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (2S)-1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-methoxybut-3-en-2-ol;7-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-ol |
| SMILES | C=C[C@H](O)C(OC)C1OC(C)(C)OC1CO.COC1C(O)OCC2OC(C)(C)OC21 |
| InChI | InChI=1S/C11H20O5.C9H16O5/c1-5-7(13)9(14-4)10-8(6-12)15-11(2,3)16-10;1-9(2)13-5-4-12-8(10)7(11-3)6(5)14-9/h5,7-10,12-13H,1,6H2,2-4H3;5-8,10H,4H2,1-3H3/t7-,8?,9?,10?;/m0./s1 |
| InChIKey | QUMPPRKWEKELCK-FOFHXTKXSA-N |
| XLogP | -0.07 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|