C12H18O5 — CID 25227839
1-[(4S,5S)-5-[(R)-hydroxy-[(2S)-oxiran-2-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-1-one (PubChem CID 25227839) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-[(4S,5S)-5-[(R)-hydroxy-[(2S)-oxiran-2-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-1-one.
| Compound Name | 1-[(4S,5S)-5-[(R)-hydroxy-[(2S)-oxiran-2-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-1-one |
|---|---|
| PubChem CID | 25227839 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-[(4S,5S)-5-[(R)-hydroxy-[(2S)-oxiran-2-yl]methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-1-one |
| SMILES | C=CCC(=O)[C@H]1OC(C)(C)O[C@H]1[C@H](O)[C@@H]1CO1 |
| InChI | InChI=1S/C12H18O5/c1-4-5-7(13)10-11(9(14)8-6-15-8)17-12(2,3)16-10/h4,8-11,14H,1,5-6H2,2-3H3/t8-,9+,10+,11-/m0/s1 |
| InChIKey | CREFTASPOIIERL-ZDCRXTMVSA-N |
| XLogP | 0.41 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|