C16H27NO8 — CID 132577385
(2S)-3-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 132577385) has the molecular formula C16H27NO8 and a molecular weight of 361.39 g/mol. Its IUPAC name is (2S)-3-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 132577385 |
| Molecular Formula | C16H27NO8 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (2S)-3-(4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | COC1OC(C[C@H](NC(=O)OC(C)(C)C)C(=O)O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C16H27NO8/c1-15(2,3)25-14(20)17-8(12(18)19)7-9-10-11(13(21-6)22-9)24-16(4,5)23-10/h8-11,13H,7H2,1-6H3,(H,17,20)(H,18,19)/t8-,9?,10?,11?,13?/m0/s1 |
| InChIKey | OMDHULMZYCTMOV-RERGEOBBSA-N |
| XLogP | 1.25 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |