C20H29NO7 — CID 101428893
[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl (E)-2-cyano-5-methylhex-2-enoate (PubChem CID 101428893) has the molecular formula C20H29NO7 and a molecular weight of 395.45 g/mol. Its IUPAC name is [(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl (E)-2-cyano-5-methylhex-2-enoate.
| Compound Name | [(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl (E)-2-cyano-5-methylhex-2-enoate |
|---|---|
| PubChem CID | 101428893 |
| Molecular Formula | C20H29NO7 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | [(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl (E)-2-cyano-5-methylhex-2-enoate |
| SMILES | CC(C)C/C=C(\C#N)C(=O)OC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C20H29NO7/c1-11(2)7-8-12(9-21)17(22)23-10-13-14-15(26-19(3,4)25-14)16-18(24-13)28-20(5,6)27-16/h8,11,13-16,18H,7,10H2,1-6H3/b12-8+/t13-,14+,15+,16-,18-/m1/s1 |
| InChIKey | KGIUCRPKTBWVSY-HVIRUPSJSA-N |
| XLogP | 2.42 |
| TPSA | 96.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|