C18H23O7 — CID 52937390
CID 52937390 (PubChem CID 52937390) has the molecular formula C18H23O7 and a molecular weight of 351.38 g/mol.
| Compound Name | CID 52937390 |
|---|---|
| PubChem CID | 52937390 |
| Molecular Formula | C18H23O7 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | — |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](COC(=O)[C]1[CH][CH][CH][CH]1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H23O7/c1-17(2)22-12-11(9-20-15(19)10-7-5-6-8-10)21-16-14(13(12)23-17)24-18(3,4)25-16/h5-8,11-14,16H,9H2,1-4H3/t11-,12+,13+,14-,16-/m1/s1 |
| InChIKey | UEXCIOXLPHOVCW-WZYWGQKZSA-N |
| XLogP | 1.33 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |