C14H21BrO7 — CID 100982029
propan-2-yl 3-[(3aR,5S,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-bromooxirane-2-carboxylate (PubChem CID 100982029) has the molecular formula C14H21BrO7 and a molecular weight of 381.22 g/mol. Its IUPAC name is propan-2-yl 3-[(3aR,5S,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-bromooxirane-2-carboxylate.
| Compound Name | propan-2-yl 3-[(3aR,5S,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-bromooxirane-2-carboxylate |
|---|---|
| PubChem CID | 100982029 |
| Molecular Formula | C14H21BrO7 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | propan-2-yl 3-[(3aR,5S,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-bromooxirane-2-carboxylate |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C1OC1(Br)C(=O)OC(C)C |
| InChI | InChI=1S/C14H21BrO7/c1-6(2)18-12(16)14(15)10(21-14)8-7(17-5)9-11(19-8)22-13(3,4)20-9/h6-11H,1-5H3/t7-,8-,9+,10?,11+,14?/m0/s1 |
| InChIKey | KRJXDZSNVWGIAZ-BHZQNPLKSA-N |
| XLogP | 1.32 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|