C28H34O9 — CID 102088505
diethyl (E)-3-[(2S,3R,4R,5R)-3-hydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]oxypent-2-enedioate (PubChem CID 102088505) has the molecular formula C28H34O9 and a molecular weight of 514.57 g/mol. Its IUPAC name is diethyl (E)-3-[(2S,3R,4R,5R)-3-hydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]oxypent-2-enedioate.
| Compound Name | diethyl (E)-3-[(2S,3R,4R,5R)-3-hydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]oxypent-2-enedioate |
|---|---|
| PubChem CID | 102088505 |
| Molecular Formula | C28H34O9 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | diethyl (E)-3-[(2S,3R,4R,5R)-3-hydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]oxypent-2-enedioate |
| SMILES | CCOC(=O)/C=C(\CC(=O)OCC)O[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C28H34O9/c1-3-33-24(29)15-22(16-25(30)34-4-2)36-28-26(31)27(35-18-21-13-9-6-10-14-21)23(37-28)19-32-17-20-11-7-5-8-12-20/h5-15,23,26-28,31H,3-4,16-19H2,1-2H3/b22-15+/t23-,26-,27+,28-/m1/s1 |
| InChIKey | LNVYXYDNEKDQMF-WGIFJPLSSA-N |
| XLogP | 3.29 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|