C30H48O4 — CID 69306301
1,5-diphenylpentane-2,4-diol;2,2,8,8-tetramethylnonane-3,7-diol (PubChem CID 69306301) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is 1,5-diphenylpentane-2,4-diol;2,2,8,8-tetramethylnonane-3,7-diol.
| Compound Name | 1,5-diphenylpentane-2,4-diol;2,2,8,8-tetramethylnonane-3,7-diol |
|---|---|
| PubChem CID | 69306301 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | 1,5-diphenylpentane-2,4-diol;2,2,8,8-tetramethylnonane-3,7-diol |
| SMILES | CC(C)(C)C(O)CCCC(O)C(C)(C)C.OC(Cc1ccccc1)CC(O)Cc1ccccc1 |
| InChI | InChI=1S/C17H20O2.C13H28O2/c18-16(11-14-7-3-1-4-8-14)13-17(19)12-15-9-5-2-6-10-15;1-12(2,3)10(14)8-7-9-11(15)13(4,5)6/h1-10,16-19H,11-13H2;10-11,14-15H,7-9H2,1-6H3 |
| InChIKey | QIJWROZZGCALCU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |