C15H22Br2 — CID 63834724
1-bromo-4-(2-bromo-4,5,5-trimethylhexyl)benzene (PubChem CID 63834724) has the molecular formula C15H22Br2 and a molecular weight of 362.15 g/mol. Its IUPAC name is 1-bromo-4-(2-bromo-4,5,5-trimethylhexyl)benzene.
| Compound Name | 1-bromo-4-(2-bromo-4,5,5-trimethylhexyl)benzene |
|---|---|
| PubChem CID | 63834724 |
| Molecular Formula | C15H22Br2 |
| Molecular Weight | 362.15 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 1-bromo-4-(2-bromo-4,5,5-trimethylhexyl)benzene |
| SMILES | CC(CC(Br)Cc1ccc(Br)cc1)C(C)(C)C |
| InChI | InChI=1S/C15H22Br2/c1-11(15(2,3)4)9-14(17)10-12-5-7-13(16)8-6-12/h5-8,11,14H,9-10H2,1-4H3 |
| InChIKey | QBYQKPDGLJGYSR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.15 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|